C9H15O16P3 — CID 87520057
2-[1,1-diphosphonoethoxy(hydroxy)phosphoryl]-1-oxobutane-1,2,4-tricarboxylic acid (PubChem CID 87520057) has the molecular formula C9H15O16P3 and a molecular weight of 472.13 g/mol. Its IUPAC name is 2-[1,1-diphosphonoethoxy(hydroxy)phosphoryl]-1-oxobutane-1,2,4-tricarboxylic acid.
| Compound Name | 2-[1,1-diphosphonoethoxy(hydroxy)phosphoryl]-1-oxobutane-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 87520057 |
| Molecular Formula | C9H15O16P3 |
| Molecular Weight | 472.13 g/mol |
| Exact Mass | 471.96 |
| IUPAC Name | 2-[1,1-diphosphonoethoxy(hydroxy)phosphoryl]-1-oxobutane-1,2,4-tricarboxylic acid |
| SMILES | CC(OP(=O)(O)C(CCC(=O)O)(C(=O)O)C(=O)C(=O)O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H15O16P3/c1-8(26(17,18)19,27(20,21)22)25-28(23,24)9(7(15)16,3-2-4(10)11)5(12)6(13)14/h2-3H2,1H3,(H,10,11)(H,13,14)(H,15,16)(H,23,24)(H2,17,18,19)(H2,20,21,22) |
| InChIKey | MAVVZNIUVIYEFZ-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 290.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.13 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|