C18H14Br2N6O2 — CID 87520103
[6-bromo-2-(3-methoxyphenyl)imidazo[1,2-a]pyrazin-3-yl]-[(5-bromopyrazin-2-yl)amino]methanol (PubChem CID 87520103) has the molecular formula C18H14Br2N6O2 and a molecular weight of 506.16 g/mol. Its IUPAC name is [6-bromo-2-(3-methoxyphenyl)imidazo[1,2-a]pyrazin-3-yl]-[(5-bromopyrazin-2-yl)amino]methanol.
| Compound Name | [6-bromo-2-(3-methoxyphenyl)imidazo[1,2-a]pyrazin-3-yl]-[(5-bromopyrazin-2-yl)amino]methanol |
|---|---|
| PubChem CID | 87520103 |
| Molecular Formula | C18H14Br2N6O2 |
| Molecular Weight | 506.16 g/mol |
| Exact Mass | 503.95 |
| IUPAC Name | [6-bromo-2-(3-methoxyphenyl)imidazo[1,2-a]pyrazin-3-yl]-[(5-bromopyrazin-2-yl)amino]methanol |
| SMILES | COc1cccc(-c2nc3cnc(Br)cn3c2C(O)Nc2cnc(Br)cn2)c1 |
| InChI | InChI=1S/C18H14Br2N6O2/c1-28-11-4-2-3-10(5-11)16-17(26-9-13(20)22-8-15(26)25-16)18(27)24-14-7-21-12(19)6-23-14/h2-9,18,27H,1H3,(H,23,24) |
| InChIKey | KITGEMGLFPIYPB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.16 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|