C20H26N4O6S — CID 87522981
tert-butyl N-[[4-[(2-acetamido-1,3-thiazol-4-yl)methoxy]-2-ethylphenoxy]carbonylamino]carbamate (PubChem CID 87522981) has the molecular formula C20H26N4O6S and a molecular weight of 450.52 g/mol. Its IUPAC name is tert-butyl N-[[4-[(2-acetamido-1,3-thiazol-4-yl)methoxy]-2-ethylphenoxy]carbonylamino]carbamate.
| Compound Name | tert-butyl N-[[4-[(2-acetamido-1,3-thiazol-4-yl)methoxy]-2-ethylphenoxy]carbonylamino]carbamate |
|---|---|
| PubChem CID | 87522981 |
| Molecular Formula | C20H26N4O6S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | tert-butyl N-[[4-[(2-acetamido-1,3-thiazol-4-yl)methoxy]-2-ethylphenoxy]carbonylamino]carbamate |
| SMILES | CCc1cc(OCc2csc(NC(C)=O)n2)ccc1OC(=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H26N4O6S/c1-6-13-9-15(28-10-14-11-31-17(22-14)21-12(2)25)7-8-16(13)29-18(26)23-24-19(27)30-20(3,4)5/h7-9,11H,6,10H2,1-5H3,(H,23,26)(H,24,27)(H,21,22,25) |
| InChIKey | XSHVVUZTJBQHPD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|