C15H18N2O5S2 — CID 87522175
ethyl [3-[(2-acetamido-1,3-thiazol-4-yl)methoxy]phenyl]methanesulfonate (PubChem CID 87522175) has the molecular formula C15H18N2O5S2 and a molecular weight of 370.45 g/mol. Its IUPAC name is ethyl [3-[(2-acetamido-1,3-thiazol-4-yl)methoxy]phenyl]methanesulfonate.
| Compound Name | ethyl [3-[(2-acetamido-1,3-thiazol-4-yl)methoxy]phenyl]methanesulfonate |
|---|---|
| PubChem CID | 87522175 |
| Molecular Formula | C15H18N2O5S2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | ethyl [3-[(2-acetamido-1,3-thiazol-4-yl)methoxy]phenyl]methanesulfonate |
| SMILES | CCOS(=O)(=O)Cc1cccc(OCc2csc(NC(C)=O)n2)c1 |
| InChI | InChI=1S/C15H18N2O5S2/c1-3-22-24(19,20)10-12-5-4-6-14(7-12)21-8-13-9-23-15(17-13)16-11(2)18/h4-7,9H,3,8,10H2,1-2H3,(H,16,17,18) |
| InChIKey | UVHDNQOYPJPESN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|