C15H29NO3 — CID 87523406
2-ethyl-4-methyl-1-propan-2-ylcyclohexane;formamido acetate (PubChem CID 87523406) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-ethyl-4-methyl-1-propan-2-ylcyclohexane;formamido acetate.
| Compound Name | 2-ethyl-4-methyl-1-propan-2-ylcyclohexane;formamido acetate |
|---|---|
| PubChem CID | 87523406 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | 2-ethyl-4-methyl-1-propan-2-ylcyclohexane;formamido acetate |
| SMILES | CC(=O)ONC=O.CCC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C12H24.C3H5NO3/c1-5-11-8-10(4)6-7-12(11)9(2)3;1-3(6)7-4-2-5/h9-12H,5-8H2,1-4H3;2H,1H3,(H,4,5) |
| InChIKey | WHUGUZCRQLLTTL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|