C12H26ClNO3 — CID 87526798
1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride (PubChem CID 87526798) has the molecular formula C12H26ClNO3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride.
| Compound Name | 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride |
|---|---|
| PubChem CID | 87526798 |
| Molecular Formula | C12H26ClNO3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride |
| SMILES | C=CCC(OCC)(OCC)[N+](C)(C)OCC.[Cl-] |
| InChI | InChI=1S/C12H26NO3.ClH/c1-7-11-12(14-8-2,15-9-3)13(5,6)16-10-4;/h7H,1,8-11H2,2-6H3;1H/q+1;/p-1 |
| InChIKey | VMMHJWXKCZBEJS-UHFFFAOYSA-M |
| XLogP | -0.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|