1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride

C12H26ClNO3 — CID 87526798

IUPAC1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride
SMILESC=CCC(OCC)(OCC)[N+](C)(C)OCC.[Cl-]
InChIInChI=1S/C12H26NO3.ClH/c1-7-11-12(14-8-2,15-9-3)13(5,6)16-10-4;/h7H,1,8-11H2,2-6H3;1H/q+1;/p-1
InChIKeyVMMHJWXKCZBEJS-UHFFFAOYSA-M
MW267.80 g/mol
LogP-0.68
Rot. Bonds9

About 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride

1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride (PubChem CID 87526798) has the molecular formula C12H26ClNO3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride.

Molecular Properties

Compound Name1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride
PubChem CID87526798
Molecular FormulaC12H26ClNO3
Molecular Weight267.80 g/mol
Exact Mass267.16
IUPAC Name1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride
SMILESC=CCC(OCC)(OCC)[N+](C)(C)OCC.[Cl-]
InChIInChI=1S/C12H26NO3.ClH/c1-7-11-12(14-8-2,15-9-3)13(5,6)16-10-4;/h7H,1,8-11H2,2-6H3;1H/q+1;/p-1
InChIKeyVMMHJWXKCZBEJS-UHFFFAOYSA-M
XLogP-0.68
TPSA27.69 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.80
LogP ≤ 5-0.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride?
The IUPAC name of 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride (CID 87526798) is 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride.
What is the SMILES notation for 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride?
The canonical SMILES for 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride is C=CCC(OCC)(OCC)[N+](C)(C)OCC.[Cl-].
What is the InChIKey of 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride?
The InChIKey is VMMHJWXKCZBEJS-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H26NO3.ClH/c1-7-11-12(14-8-2,15-9-3)13(5,6)16-10-4;/h7H,1,8-11H2,2-6H3;1H/q+1;/p-1.
What are the key properties of 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride?
1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride has a molecular weight of 267.80 g/mol, XLogP of -0.68, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethoxybut-3-enyl-ethoxy-dimethylazanium chloride is sourced from PubChem (CID 87526798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).