About 1,1-difluoroethene;hydrochloride
1,1-difluoroethene;hydrochloride (PubChem CID 87527286) has the molecular formula C2H3ClF2
and a molecular weight of 100.50 g/mol. Its IUPAC name is 1,1-difluoroethene;hydrochloride.
Molecular Properties
| Compound Name | 1,1-difluoroethene;hydrochloride |
| PubChem CID | 87527286 |
| Molecular Formula | C2H3ClF2 |
| Molecular Weight | 100.50 g/mol |
| Exact Mass | 99.99 |
| IUPAC Name | 1,1-difluoroethene;hydrochloride |
| SMILES | C=C(F)F.Cl |
| InChI | InChI=1S/C2H2F2.ClH/c1-2(3)4;/h1H2;1H |
| InChIKey | VANWFJFIBPQSIT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-difluoroethene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoroethene;hydrochloride?
The IUPAC name of 1,1-difluoroethene;hydrochloride (CID 87527286) is 1,1-difluoroethene;hydrochloride.
What is the SMILES notation for 1,1-difluoroethene;hydrochloride?
The canonical SMILES for 1,1-difluoroethene;hydrochloride is C=C(F)F.Cl.
What is the InChIKey of 1,1-difluoroethene;hydrochloride?
The InChIKey is VANWFJFIBPQSIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2F2.ClH/c1-2(3)4;/h1H2;1H.
What are the key properties of 1,1-difluoroethene;hydrochloride?
1,1-difluoroethene;hydrochloride has a molecular weight of 100.50 g/mol, XLogP of 1.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroethene;hydrochloride is sourced from PubChem (CID 87527286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).