C2HF3 — CID 9665
1,1,2-trifluoroethene (PubChem CID 9665) has the molecular formula C2HF3 and a molecular weight of 82.02 g/mol. Its IUPAC name is 1,1,2-trifluoroethene.
| Compound Name | 1,1,2-trifluoroethene |
|---|---|
| PubChem CID | 9665 |
| Molecular Formula | C2HF3 |
| Molecular Weight | 82.02 g/mol |
| Exact Mass | 82.00 |
| IUPAC Name | 1,1,2-trifluoroethene |
| SMILES | FC=C(F)F |
| InChI | InChI=1S/C2HF3/c3-1-2(4)5/h1H |
| InChIKey | MIZLGWKEZAPEFJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 82.02 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |