C10H8BN5O2 — CID 87527598
CID 87527598 (PubChem CID 87527598) has the molecular formula C10H8BN5O2 and a molecular weight of 241.02 g/mol.
| Compound Name | CID 87527598 |
|---|---|
| PubChem CID | 87527598 |
| Molecular Formula | C10H8BN5O2 |
| Molecular Weight | 241.02 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2nn(Cc3nc(C)no3)c(=O)n2c1 |
| InChI | InChI=1S/C10H8BN5O2/c1-6-12-9(18-14-6)5-16-10(17)15-4-7(11)2-3-8(15)13-16/h2-4H,5H2,1H3 |
| InChIKey | MEWLPHREQVTXSX-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 78.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.02 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|