C13H20ClMgNO — CID 87528523
magnesium;N,N-diethyl-3-(phenoxy)propan-1-amine;chloride (PubChem CID 87528523) has the molecular formula C13H20ClMgNO and a molecular weight of 266.07 g/mol. Its IUPAC name is magnesium;N,N-diethyl-3-(phenoxy)propan-1-amine;chloride.
| Compound Name | magnesium;N,N-diethyl-3-(phenoxy)propan-1-amine;chloride |
|---|---|
| PubChem CID | 87528523 |
| Molecular Formula | C13H20ClMgNO |
| Molecular Weight | 266.07 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | magnesium;N,N-diethyl-3-(phenoxy)propan-1-amine;chloride |
| SMILES | CCN(CC)CCCOc1cc[c-]cc1.[Cl-].[Mg+2] |
| InChI | InChI=1S/C13H20NO.ClH.Mg/c1-3-14(4-2)11-8-12-15-13-9-6-5-7-10-13;;/h6-7,9-10H,3-4,8,11-12H2,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | UYEGUKNXFNQMSR-UHFFFAOYSA-M |
| XLogP | -0.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.07 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|