C20H22BrN3O3 — CID 87529684
2-(2-bromo-4,5-dimethoxyphenyl)-2-[5-[4-(methylamino)phenyl]-3,4-dihydropyrazol-2-yl]acetaldehyde (PubChem CID 87529684) has the molecular formula C20H22BrN3O3 and a molecular weight of 432.32 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-2-[5-[4-(methylamino)phenyl]-3,4-dihydropyrazol-2-yl]acetaldehyde.
| Compound Name | 2-(2-bromo-4,5-dimethoxyphenyl)-2-[5-[4-(methylamino)phenyl]-3,4-dihydropyrazol-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 87529684 |
| Molecular Formula | C20H22BrN3O3 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 2-(2-bromo-4,5-dimethoxyphenyl)-2-[5-[4-(methylamino)phenyl]-3,4-dihydropyrazol-2-yl]acetaldehyde |
| SMILES | CNc1ccc(C2=NN(C(C=O)c3cc(OC)c(OC)cc3Br)CC2)cc1 |
| InChI | InChI=1S/C20H22BrN3O3/c1-22-14-6-4-13(5-7-14)17-8-9-24(23-17)18(12-25)15-10-19(26-2)20(27-3)11-16(15)21/h4-7,10-12,18,22H,8-9H2,1-3H3 |
| InChIKey | PNNYPJYPFUCJNC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|