C28H22N2O3S — CID 87529917
2,4-dioxo-3-(2-phenylethyl)-1-[(4-phenylphenyl)methyl]thieno[2,3-d]pyrimidine-6-carbaldehyde (PubChem CID 87529917) has the molecular formula C28H22N2O3S and a molecular weight of 466.56 g/mol. Its IUPAC name is 2,4-dioxo-3-(2-phenylethyl)-1-[(4-phenylphenyl)methyl]thieno[2,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 2,4-dioxo-3-(2-phenylethyl)-1-[(4-phenylphenyl)methyl]thieno[2,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 87529917 |
| Molecular Formula | C28H22N2O3S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2,4-dioxo-3-(2-phenylethyl)-1-[(4-phenylphenyl)methyl]thieno[2,3-d]pyrimidine-6-carbaldehyde |
| SMILES | O=Cc1cc2c(=O)n(CCc3ccccc3)c(=O)n(Cc3ccc(-c4ccccc4)cc3)c2s1 |
| InChI | InChI=1S/C28H22N2O3S/c31-19-24-17-25-26(32)29(16-15-20-7-3-1-4-8-20)28(33)30(27(25)34-24)18-21-11-13-23(14-12-21)22-9-5-2-6-10-22/h1-14,17,19H,15-16,18H2 |
| InChIKey | YCGXANJXBMSQQN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|