C26H22N2O5 — CID 87534955
1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-3-pyren-1-ylpyrimidine-2,4-dione (PubChem CID 87534955) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-3-pyren-1-ylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-3-pyren-1-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87534955 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-3-pyren-1-ylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CC(O)[C@@H](CO)O2)c(=O)n(-c2ccc3ccc4cccc5ccc2c3c45)c1=O |
| InChI | InChI=1S/C26H22N2O5/c1-14-12-27(22-11-20(30)21(13-29)33-22)26(32)28(25(14)31)19-10-8-17-6-5-15-3-2-4-16-7-9-18(19)24(17)23(15)16/h2-10,12,20-22,29-30H,11,13H2,1H3/t20?,21-,22-/m1/s1 |
| InChIKey | WTJQKGZHWHSREA-HRUVVLKGSA-N |
| XLogP | 2.85 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|