C28H16F4O7S — CID 87537162
2-fluoro-3,4,5-trifluorooxybenzoate;(2-oxochromen-7-yl)-diphenylsulfanium (PubChem CID 87537162) has the molecular formula C28H16F4O7S and a molecular weight of 572.49 g/mol. Its IUPAC name is 2-fluoro-3,4,5-trifluorooxybenzoate;(2-oxochromen-7-yl)-diphenylsulfanium.
| Compound Name | 2-fluoro-3,4,5-trifluorooxybenzoate;(2-oxochromen-7-yl)-diphenylsulfanium |
|---|---|
| PubChem CID | 87537162 |
| Molecular Formula | C28H16F4O7S |
| Molecular Weight | 572.49 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | 2-fluoro-3,4,5-trifluorooxybenzoate;(2-oxochromen-7-yl)-diphenylsulfanium |
| SMILES | O=C([O-])c1cc(OF)c(OF)c(OF)c1F.O=c1ccc2ccc([S+](c3ccccc3)c3ccccc3)cc2o1 |
| InChI | InChI=1S/C21H15O2S.C7H2F4O5/c22-21-14-12-16-11-13-19(15-20(16)23-21)24(17-7-3-1-4-8-17)18-9-5-2-6-10-18;8-4-2(7(12)13)1-3(14-9)5(15-10)6(4)16-11/h1-15H;1H,(H,12,13)/q+1;/p-1 |
| InChIKey | UZMZLMHHPQPCDX-UHFFFAOYSA-M |
| XLogP | 5.87 |
| TPSA | 98.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|