C16H8F4O7S — CID 87768281
(2-oxochromen-7-yl) 2,6-difluoro-3,4-difluorooxy-5-hydroxybenzoate;sulfane (PubChem CID 87768281) has the molecular formula C16H8F4O7S and a molecular weight of 420.29 g/mol. Its IUPAC name is (2-oxochromen-7-yl) 2,6-difluoro-3,4-difluorooxy-5-hydroxybenzoate;sulfane.
| Compound Name | (2-oxochromen-7-yl) 2,6-difluoro-3,4-difluorooxy-5-hydroxybenzoate;sulfane |
|---|---|
| PubChem CID | 87768281 |
| Molecular Formula | C16H8F4O7S |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | (2-oxochromen-7-yl) 2,6-difluoro-3,4-difluorooxy-5-hydroxybenzoate;sulfane |
| SMILES | O=C(Oc1ccc2ccc(=O)oc2c1)c1c(F)c(O)c(OF)c(OF)c1F.S |
| InChI | InChI=1S/C16H6F4O7.H2S/c17-11-10(12(18)14(26-19)15(27-20)13(11)22)16(23)24-7-3-1-6-2-4-9(21)25-8(6)5-7;/h1-5,22H;1H2 |
| InChIKey | UCCQRAXJYWOPHT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|