C22H22N2O6S — CID 87545226
ethyl 2-[3-hydroxy-4-[2-[6-(methylsulfanyliminomethylidene)-3-oxo-1,7-dihydroisoindol-2-yl]acetyl]phenoxy]acetate (PubChem CID 87545226) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is ethyl 2-[3-hydroxy-4-[2-[6-(methylsulfanyliminomethylidene)-3-oxo-1,7-dihydroisoindol-2-yl]acetyl]phenoxy]acetate.
| Compound Name | ethyl 2-[3-hydroxy-4-[2-[6-(methylsulfanyliminomethylidene)-3-oxo-1,7-dihydroisoindol-2-yl]acetyl]phenoxy]acetate |
|---|---|
| PubChem CID | 87545226 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | ethyl 2-[3-hydroxy-4-[2-[6-(methylsulfanyliminomethylidene)-3-oxo-1,7-dihydroisoindol-2-yl]acetyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C(=O)CN2CC3=C(C=CC(=C=NSC)C3)C2=O)c(O)c1 |
| InChI | InChI=1S/C22H22N2O6S/c1-3-29-21(27)13-30-16-5-7-18(19(25)9-16)20(26)12-24-11-15-8-14(10-23-31-2)4-6-17(15)22(24)28/h4-7,9,25H,3,8,11-13H2,1-2H3 |
| InChIKey | CXPWZYUKYKRZFO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|