C12H31N3O4Si — CID 87546396
(2S)-2,6-diaminohexanoic acid;3-[dimethoxy(methyl)silyl]propan-1-amine (PubChem CID 87546396) has the molecular formula C12H31N3O4Si and a molecular weight of 309.48 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;3-[dimethoxy(methyl)silyl]propan-1-amine.
| Compound Name | (2S)-2,6-diaminohexanoic acid;3-[dimethoxy(methyl)silyl]propan-1-amine |
|---|---|
| PubChem CID | 87546396 |
| Molecular Formula | C12H31N3O4Si |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;3-[dimethoxy(methyl)silyl]propan-1-amine |
| SMILES | CO[Si](C)(CCCN)OC.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2.C6H17NO2Si/c7-4-2-1-3-5(8)6(9)10;1-8-10(3,9-2)6-4-5-7/h5H,1-4,7-8H2,(H,9,10);4-7H2,1-3H3/t5-;/m0./s1 |
| InChIKey | RNBDIVVXMZTOKY-JEDNCBNOSA-N |
| XLogP | 0.23 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|