C24H25FN2O5 — CID 87548598
2-[(2S)-1,3-dioxo-2-(2-oxopyrrolidin-1-yl)-1-[[(1S)-1-phenylpropyl]amino]butan-2-yl]-6-fluorobenzoic acid (PubChem CID 87548598) has the molecular formula C24H25FN2O5 and a molecular weight of 440.47 g/mol. Its IUPAC name is 2-[(2S)-1,3-dioxo-2-(2-oxopyrrolidin-1-yl)-1-[[(1S)-1-phenylpropyl]amino]butan-2-yl]-6-fluorobenzoic acid.
| Compound Name | 2-[(2S)-1,3-dioxo-2-(2-oxopyrrolidin-1-yl)-1-[[(1S)-1-phenylpropyl]amino]butan-2-yl]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 87548598 |
| Molecular Formula | C24H25FN2O5 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-[(2S)-1,3-dioxo-2-(2-oxopyrrolidin-1-yl)-1-[[(1S)-1-phenylpropyl]amino]butan-2-yl]-6-fluorobenzoic acid |
| SMILES | CC[C@H](NC(=O)[C@@](C(C)=O)(c1cccc(F)c1C(=O)O)N1CCCC1=O)c1ccccc1 |
| InChI | InChI=1S/C24H25FN2O5/c1-3-19(16-9-5-4-6-10-16)26-23(32)24(15(2)28,27-14-8-13-20(27)29)17-11-7-12-18(25)21(17)22(30)31/h4-7,9-12,19H,3,8,13-14H2,1-2H3,(H,26,32)(H,30,31)/t19-,24+/m0/s1 |
| InChIKey | ORCKYJSIVPYHGS-YADARESESA-N |
| XLogP | 3.20 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|