C26H50O3 — CID 87553559
2-ethylhexyl (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 87553559) has the molecular formula C26H50O3 and a molecular weight of 410.68 g/mol. Its IUPAC name is 2-ethylhexyl (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | 2-ethylhexyl (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 87553559 |
| Molecular Formula | C26H50O3 |
| Molecular Weight | 410.68 g/mol |
| Exact Mass | 410.38 |
| IUPAC Name | 2-ethylhexyl (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C26H50O3/c1-4-7-9-16-20-25(27)21-17-14-12-10-11-13-15-18-22-26(28)29-23-24(6-3)19-8-5-2/h14,17,24-25,27H,4-13,15-16,18-23H2,1-3H3/b17-14-/t24?,25-/m1/s1 |
| InChIKey | QGAMWLCOVJRSGM-SQRAKKIQSA-N |
| XLogP | 7.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.68 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|