C23H22N2O2 — CID 8755570
(2R)-2-[[(R)-furan-2-yl(phenyl)methyl]amino]-1-(2-methyl-1H-indol-3-yl)propan-1-one (PubChem CID 8755570) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is (2R)-2-[[(R)-furan-2-yl(phenyl)methyl]amino]-1-(2-methyl-1H-indol-3-yl)propan-1-one.
| Compound Name | (2R)-2-[[(R)-furan-2-yl(phenyl)methyl]amino]-1-(2-methyl-1H-indol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 8755570 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (2R)-2-[[(R)-furan-2-yl(phenyl)methyl]amino]-1-(2-methyl-1H-indol-3-yl)propan-1-one |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@@H](C)N[C@H](c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C23H22N2O2/c1-15-21(18-11-6-7-12-19(18)24-15)23(26)16(2)25-22(20-13-8-14-27-20)17-9-4-3-5-10-17/h3-14,16,22,24-25H,1-2H3/t16-,22-/m1/s1 |
| InChIKey | BAZXYIVFPXBPMA-OPAMFIHVSA-N |
| XLogP | 5.02 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |