About O-(3-methylpentyl) methanethioate
O-(3-methylpentyl) methanethioate (PubChem CID 87569073) has the molecular formula C7H14OS
and a molecular weight of 146.26 g/mol. Its IUPAC name is O-(3-methylpentyl) methanethioate.
Molecular Properties
| Compound Name | O-(3-methylpentyl) methanethioate |
| PubChem CID | 87569073 |
| Molecular Formula | C7H14OS |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | O-(3-methylpentyl) methanethioate |
| SMILES | CCC(C)CCOC=S |
| InChI | InChI=1S/C7H14OS/c1-3-7(2)4-5-8-6-9/h6-7H,3-5H2,1-2H3 |
| InChIKey | FFDMRMOWLPHYLM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(3-methylpentyl) methanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(3-methylpentyl) methanethioate?
The IUPAC name of O-(3-methylpentyl) methanethioate (CID 87569073) is O-(3-methylpentyl) methanethioate.
What is the SMILES notation for O-(3-methylpentyl) methanethioate?
The canonical SMILES for O-(3-methylpentyl) methanethioate is CCC(C)CCOC=S.
What is the InChIKey of O-(3-methylpentyl) methanethioate?
The InChIKey is FFDMRMOWLPHYLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14OS/c1-3-7(2)4-5-8-6-9/h6-7H,3-5H2,1-2H3.
What are the key properties of O-(3-methylpentyl) methanethioate?
O-(3-methylpentyl) methanethioate has a molecular weight of 146.26 g/mol, XLogP of 2.40, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-(3-methylpentyl) methanethioate is sourced from PubChem (CID 87569073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).