C17H30F3N3O3 — CID 87571266
N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-[(2,2,2-trifluoroacetyl)amino]hexanamide (PubChem CID 87571266) has the molecular formula C17H30F3N3O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-[(2,2,2-trifluoroacetyl)amino]hexanamide.
| Compound Name | N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 87571266 |
| Molecular Formula | C17H30F3N3O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
| SMILES | CC1(C)CC(NC(=O)CCCCCNC(=O)C(F)(F)F)CC(C)(C)N1O |
| InChI | InChI=1S/C17H30F3N3O3/c1-15(2)10-12(11-16(3,4)23(15)26)22-13(24)8-6-5-7-9-21-14(25)17(18,19)20/h12,26H,5-11H2,1-4H3,(H,21,25)(H,22,24) |
| InChIKey | FZEKPXIRXKUNDS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|