C22H21N5O3 — CID 87571267
N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide (PubChem CID 87571267) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide.
| Compound Name | N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide |
|---|---|
| PubChem CID | 87571267 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide |
| SMILES | COc1ncc(-c2cccc(-n3cnc4cc([C@H](C)NC=O)ccc43)c2)c(OC)n1 |
| InChI | InChI=1S/C22H21N5O3/c1-14(25-13-28)15-7-8-20-19(10-15)24-12-27(20)17-6-4-5-16(9-17)18-11-23-22(30-3)26-21(18)29-2/h4-14H,1-3H3,(H,25,28)/t14-/m0/s1 |
| InChIKey | BEZWQFDHNMAXGX-AWEZNQCLSA-N |
| XLogP | 3.31 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|