About N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide
N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide (PubChem CID 87571267) has the molecular formula C22H21N5O3
and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide.
Molecular Properties
| Compound Name | N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide |
| PubChem CID | 87571267 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide |
| SMILES | COc1ncc(-c2cccc(-n3cnc4cc([C@H](C)NC=O)ccc43)c2)c(OC)n1 |
| InChI | InChI=1S/C22H21N5O3/c1-14(25-13-28)15-7-8-20-19(10-15)24-12-27(20)17-6-4-5-16(9-17)18-11-23-22(30-3)26-21(18)29-2/h4-14H,1-3H3,(H,25,28)/t14-/m0/s1 |
| InChIKey | BEZWQFDHNMAXGX-AWEZNQCLSA-N |
| XLogP | 3.31 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide?
The IUPAC name of N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide (CID 87571267) is N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide.
What is the SMILES notation for N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide?
The canonical SMILES for N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide is COc1ncc(-c2cccc(-n3cnc4cc([C@H](C)NC=O)ccc43)c2)c(OC)n1.
What is the InChIKey of N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide?
The InChIKey is BEZWQFDHNMAXGX-AWEZNQCLSA-N. The full InChI is InChI=1S/C22H21N5O3/c1-14(25-13-28)15-7-8-20-19(10-15)24-12-27(20)17-6-4-5-16(9-17)18-11-23-22(30-3)26-21(18)29-2/h4-14H,1-3H3,(H,25,28)/t14-/m0/s1.
What are the key properties of N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide?
N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide has a molecular weight of 403.44 g/mol, XLogP of 3.31, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]benzimidazol-5-yl]ethyl]formamide is sourced from PubChem (CID 87571267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).