C6H12ClNO4S — CID 87571308
N-chloro-1-(2,2-dimethyl-1,3-dioxolan-4-yl)methanesulfonamide (PubChem CID 87571308) has the molecular formula C6H12ClNO4S and a molecular weight of 229.68 g/mol. Its IUPAC name is N-chloro-1-(2,2-dimethyl-1,3-dioxolan-4-yl)methanesulfonamide.
| Compound Name | N-chloro-1-(2,2-dimethyl-1,3-dioxolan-4-yl)methanesulfonamide |
|---|---|
| PubChem CID | 87571308 |
| Molecular Formula | C6H12ClNO4S |
| Molecular Weight | 229.68 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | N-chloro-1-(2,2-dimethyl-1,3-dioxolan-4-yl)methanesulfonamide |
| SMILES | CC1(C)OCC(CS(=O)(=O)NCl)O1 |
| InChI | InChI=1S/C6H12ClNO4S/c1-6(2)11-3-5(12-6)4-13(9,10)8-7/h5,8H,3-4H2,1-2H3 |
| InChIKey | MSYDAQSTLNRBLW-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.68 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|