C14H33NSi2 — CID 87571553
N-[[tert-butyl(dimethyl)silyl]methyl]-3-[ethenyl(dimethyl)silyl]propan-1-amine (PubChem CID 87571553) has the molecular formula C14H33NSi2 and a molecular weight of 271.60 g/mol. Its IUPAC name is N-[[tert-butyl(dimethyl)silyl]methyl]-3-[ethenyl(dimethyl)silyl]propan-1-amine.
| Compound Name | N-[[tert-butyl(dimethyl)silyl]methyl]-3-[ethenyl(dimethyl)silyl]propan-1-amine |
|---|---|
| PubChem CID | 87571553 |
| Molecular Formula | C14H33NSi2 |
| Molecular Weight | 271.60 g/mol |
| Exact Mass | 271.22 |
| IUPAC Name | N-[[tert-butyl(dimethyl)silyl]methyl]-3-[ethenyl(dimethyl)silyl]propan-1-amine |
| SMILES | C=C[Si](C)(C)CCCNC[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H33NSi2/c1-9-16(5,6)12-10-11-15-13-17(7,8)14(2,3)4/h9,15H,1,10-13H2,2-8H3 |
| InChIKey | MBOJUDKPDVCRFO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|