C13H31NSi2 — CID 87573006
N-[[tert-butyl(dimethyl)silyl]methyl]-2-[ethenyl(dimethyl)silyl]ethanamine (PubChem CID 87573006) has the molecular formula C13H31NSi2 and a molecular weight of 257.57 g/mol. Its IUPAC name is N-[[tert-butyl(dimethyl)silyl]methyl]-2-[ethenyl(dimethyl)silyl]ethanamine.
| Compound Name | N-[[tert-butyl(dimethyl)silyl]methyl]-2-[ethenyl(dimethyl)silyl]ethanamine |
|---|---|
| PubChem CID | 87573006 |
| Molecular Formula | C13H31NSi2 |
| Molecular Weight | 257.57 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | N-[[tert-butyl(dimethyl)silyl]methyl]-2-[ethenyl(dimethyl)silyl]ethanamine |
| SMILES | C=C[Si](C)(C)CCNC[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H31NSi2/c1-9-15(5,6)11-10-14-12-16(7,8)13(2,3)4/h9,14H,1,10-12H2,2-8H3 |
| InChIKey | VVQLYDJGKBNTAN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|