About hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium)
hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium) (PubChem CID 87573240) has the molecular formula C10H28F6N2O2Ti
and a molecular weight of 370.20 g/mol. Its IUPAC name is hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium).
Molecular Properties
| Compound Name | hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium) |
| PubChem CID | 87573240 |
| Molecular Formula | C10H28F6N2O2Ti |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium) |
| SMILES | C[N+](C)(C)CCO.C[N+](C)(C)CCO.F[Ti-2](F)(F)(F)(F)F |
| InChI | InChI=1S/2C5H14NO.6FH.Ti/c2*1-6(2,3)4-5-7;;;;;;;/h2*7H,4-5H2,1-3H3;6*1H;/q2*+1;;;;;;;+4/p-6 |
| InChIKey | SEUCSFSEVVTBHK-UHFFFAOYSA-H |
| XLogP | 1.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium)?
The IUPAC name of hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium) (CID 87573240) is hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium).
What is the SMILES notation for hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium)?
The canonical SMILES for hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium) is C[N+](C)(C)CCO.C[N+](C)(C)CCO.F[Ti-2](F)(F)(F)(F)F.
What is the InChIKey of hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium)?
The InChIKey is SEUCSFSEVVTBHK-UHFFFAOYSA-H. The full InChI is InChI=1S/2C5H14NO.6FH.Ti/c2*1-6(2,3)4-5-7;;;;;;;/h2*7H,4-5H2,1-3H3;6*1H;/q2*+1;;;;;;;+4/p-6.
What are the key properties of hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium)?
hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium) has a molecular weight of 370.20 g/mol, XLogP of 1.89, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluorotitanium(2-);bis(2-hydroxyethyl(trimethyl)azanium) is sourced from PubChem (CID 87573240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).