C19H24Cl2N2O4 — CID 87573465
[1-[[6-chloro-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methanamine;hydrochloride (PubChem CID 87573465) has the molecular formula C19H24Cl2N2O4 and a molecular weight of 415.32 g/mol. Its IUPAC name is [1-[[6-chloro-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methanamine;hydrochloride.
| Compound Name | [1-[[6-chloro-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 87573465 |
| Molecular Formula | C19H24Cl2N2O4 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [1-[[6-chloro-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methanamine;hydrochloride |
| SMILES | COc1cc(-c2cc(OCC3(CN)CC3)cnc2Cl)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C19H23ClN2O4.ClH/c1-23-15-6-12(7-16(24-2)17(15)25-3)14-8-13(9-22-18(14)20)26-11-19(10-21)4-5-19;/h6-9H,4-5,10-11,21H2,1-3H3;1H |
| InChIKey | RSVUTCDWEDBDMG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|