C16H18Cl3FN2O — CID 68780892
[1-[[5-(3-chlorophenyl)-6-fluoro-3-pyridinyl]oxymethyl]cyclopropyl]methanamine;dihydrochloride (PubChem CID 68780892) has the molecular formula C16H18Cl3FN2O and a molecular weight of 379.69 g/mol. Its IUPAC name is [1-[[5-(3-chlorophenyl)-6-fluoro-3-pyridinyl]oxymethyl]cyclopropyl]methanamine;dihydrochloride.
| Compound Name | [1-[[5-(3-chlorophenyl)-6-fluoro-3-pyridinyl]oxymethyl]cyclopropyl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 68780892 |
| Molecular Formula | C16H18Cl3FN2O |
| Molecular Weight | 379.69 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [1-[[5-(3-chlorophenyl)-6-fluoro-3-pyridinyl]oxymethyl]cyclopropyl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCC1(COc2cnc(F)c(-c3cccc(Cl)c3)c2)CC1 |
| InChI | InChI=1S/C16H16ClFN2O.2ClH/c17-12-3-1-2-11(6-12)14-7-13(8-20-15(14)18)21-10-16(9-19)4-5-16;;/h1-3,6-8H,4-5,9-10,19H2;2*1H |
| InChIKey | KVOICJKAHVXFKP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.69 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|