C16H20Cl2FN3O — CID 68781108
4-[2-fluoro-5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]aniline;dihydrochloride (PubChem CID 68781108) has the molecular formula C16H20Cl2FN3O and a molecular weight of 360.26 g/mol. Its IUPAC name is 4-[2-fluoro-5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]aniline;dihydrochloride.
| Compound Name | 4-[2-fluoro-5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 68781108 |
| Molecular Formula | C16H20Cl2FN3O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 4-[2-fluoro-5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]aniline;dihydrochloride |
| SMILES | CNC1(COc2cnc(F)c(-c3ccc(N)cc3)c2)CC1.Cl.Cl |
| InChI | InChI=1S/C16H18FN3O.2ClH/c1-19-16(6-7-16)10-21-13-8-14(15(17)20-9-13)11-2-4-12(18)5-3-11;;/h2-5,8-9,19H,6-7,10,18H2,1H3;2*1H |
| InChIKey | GOMDOYPQGLCNDT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|