C17H19Cl3N2O3 — CID 140558262
4-[2-chloro-5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride (PubChem CID 140558262) has the molecular formula C17H19Cl3N2O3 and a molecular weight of 405.71 g/mol. Its IUPAC name is 4-[2-chloro-5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride.
| Compound Name | 4-[2-chloro-5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride |
|---|---|
| PubChem CID | 140558262 |
| Molecular Formula | C17H19Cl3N2O3 |
| Molecular Weight | 405.71 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 4-[2-chloro-5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]benzoic acid;dihydrochloride |
| SMILES | CNC1(COc2cnc(Cl)c(-c3ccc(C(=O)O)cc3)c2)CC1.Cl.Cl |
| InChI | InChI=1S/C17H17ClN2O3.2ClH/c1-19-17(6-7-17)10-23-13-8-14(15(18)20-9-13)11-2-4-12(5-3-11)16(21)22;;/h2-5,8-9,19H,6-7,10H2,1H3,(H,21,22);2*1H |
| InChIKey | PJEQGQDQSVGMRW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.71 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|