C18H19Cl2N3O2 — CID 142785716
N-[2-chloro-4-[2-chloro-5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]phenyl]acetamide (PubChem CID 142785716) has the molecular formula C18H19Cl2N3O2 and a molecular weight of 380.28 g/mol. Its IUPAC name is N-[2-chloro-4-[2-chloro-5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]phenyl]acetamide.
| Compound Name | N-[2-chloro-4-[2-chloro-5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]phenyl]acetamide |
|---|---|
| PubChem CID | 142785716 |
| Molecular Formula | C18H19Cl2N3O2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-[2-chloro-4-[2-chloro-5-[[1-(methylamino)cyclopropyl]methoxy]-3-pyridinyl]phenyl]acetamide |
| SMILES | CNC1(COc2cnc(Cl)c(-c3ccc(NC(C)=O)c(Cl)c3)c2)CC1 |
| InChI | InChI=1S/C18H19Cl2N3O2/c1-11(24)23-16-4-3-12(7-15(16)19)14-8-13(9-22-17(14)20)25-10-18(21-2)5-6-18/h3-4,7-9,21H,5-6,10H2,1-2H3,(H,23,24) |
| InChIKey | NLWDJTPHJKWZAL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|