C25H27ClN2O3 — CID 130188351
2-chloro-5-(4-piperidin-1-ylphenyl)-3-(3,4,5-trimethoxyphenyl)pyridine (PubChem CID 130188351) has the molecular formula C25H27ClN2O3 and a molecular weight of 438.96 g/mol. Its IUPAC name is 2-chloro-5-(4-piperidin-1-ylphenyl)-3-(3,4,5-trimethoxyphenyl)pyridine.
| Compound Name | 2-chloro-5-(4-piperidin-1-ylphenyl)-3-(3,4,5-trimethoxyphenyl)pyridine |
|---|---|
| PubChem CID | 130188351 |
| Molecular Formula | C25H27ClN2O3 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-chloro-5-(4-piperidin-1-ylphenyl)-3-(3,4,5-trimethoxyphenyl)pyridine |
| SMILES | COc1cc(-c2cc(-c3ccc(N4CCCCC4)cc3)cnc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C25H27ClN2O3/c1-29-22-14-18(15-23(30-2)24(22)31-3)21-13-19(16-27-25(21)26)17-7-9-20(10-8-17)28-11-5-4-6-12-28/h7-10,13-16H,4-6,11-12H2,1-3H3 |
| InChIKey | RSAOAVGEJSRDHW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|