C18H12N2O3 — CID 87575200
methyl 7-formyl-5-(2-phenylethynyl)-2H-indazole-3-carboxylate (PubChem CID 87575200) has the molecular formula C18H12N2O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is methyl 7-formyl-5-(2-phenylethynyl)-2H-indazole-3-carboxylate.
| Compound Name | methyl 7-formyl-5-(2-phenylethynyl)-2H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 87575200 |
| Molecular Formula | C18H12N2O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | methyl 7-formyl-5-(2-phenylethynyl)-2H-indazole-3-carboxylate |
| SMILES | COC(=O)c1[nH]nc2c(C=O)cc(C#Cc3ccccc3)cc12 |
| InChI | InChI=1S/C18H12N2O3/c1-23-18(22)17-15-10-13(8-7-12-5-3-2-4-6-12)9-14(11-21)16(15)19-20-17/h2-6,9-11H,1H3,(H,19,20) |
| InChIKey | RPYYOMRGEFMNJD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|