C20H18ClN3O3 — CID 8757601
1-(3-chlorophenyl)-3-[[(2R)-2-naphthalen-2-yloxypropanoyl]amino]urea (PubChem CID 8757601) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[(2R)-2-naphthalen-2-yloxypropanoyl]amino]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[[(2R)-2-naphthalen-2-yloxypropanoyl]amino]urea |
|---|---|
| PubChem CID | 8757601 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[(2R)-2-naphthalen-2-yloxypropanoyl]amino]urea |
| SMILES | C[C@@H](Oc1ccc2ccccc2c1)C(=O)NNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H18ClN3O3/c1-13(27-18-10-9-14-5-2-3-6-15(14)11-18)19(25)23-24-20(26)22-17-8-4-7-16(21)12-17/h2-13H,1H3,(H,23,25)(H2,22,24,26)/t13-/m1/s1 |
| InChIKey | KULNDPZJOQBMAB-CYBMUJFWSA-N |
| XLogP | 4.11 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|