About propanimidoylsulfanyl propanimidothioate
propanimidoylsulfanyl propanimidothioate (PubChem CID 87580504) has the molecular formula C6H12N2S2
and a molecular weight of 176.31 g/mol. Its IUPAC name is propanimidoylsulfanyl propanimidothioate.
Molecular Properties
| Compound Name | propanimidoylsulfanyl propanimidothioate |
| PubChem CID | 87580504 |
| Molecular Formula | C6H12N2S2 |
| Molecular Weight | 176.31 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | propanimidoylsulfanyl propanimidothioate |
| SMILES | [H]/N=C(\CC)SS/C(CC)=N/[H] |
| InChI | InChI=1S/C6H12N2S2/c1-3-5(7)9-10-6(8)4-2/h7-8H,3-4H2,1-2H3/b7-5+,8-6+ |
| InChIKey | QPCOYWOFZAWVBE-KQQUZDAGSA-N |
| XLogP | 3.14 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propanimidoylsulfanyl propanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanimidoylsulfanyl propanimidothioate?
The IUPAC name of propanimidoylsulfanyl propanimidothioate (CID 87580504) is propanimidoylsulfanyl propanimidothioate.
What is the SMILES notation for propanimidoylsulfanyl propanimidothioate?
The canonical SMILES for propanimidoylsulfanyl propanimidothioate is [H]/N=C(\CC)SS/C(CC)=N/[H].
What is the InChIKey of propanimidoylsulfanyl propanimidothioate?
The InChIKey is QPCOYWOFZAWVBE-KQQUZDAGSA-N. The full InChI is InChI=1S/C6H12N2S2/c1-3-5(7)9-10-6(8)4-2/h7-8H,3-4H2,1-2H3/b7-5+,8-6+.
What are the key properties of propanimidoylsulfanyl propanimidothioate?
propanimidoylsulfanyl propanimidothioate has a molecular weight of 176.31 g/mol, XLogP of 3.14, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propanimidoylsulfanyl propanimidothioate is sourced from PubChem (CID 87580504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).