C20H20FN5O3S — CID 87582835
9-cyclopropyl-6-fluoro-7-(8-methoxyimino-2,6-diazaspiro[3.4]octan-6-yl)-[1,2]thiazolo[5,4-b]quinoline-3,4-dione (PubChem CID 87582835) has the molecular formula C20H20FN5O3S and a molecular weight of 429.48 g/mol. Its IUPAC name is 9-cyclopropyl-6-fluoro-7-(8-methoxyimino-2,6-diazaspiro[3.4]octan-6-yl)-[1,2]thiazolo[5,4-b]quinoline-3,4-dione.
| Compound Name | 9-cyclopropyl-6-fluoro-7-(8-methoxyimino-2,6-diazaspiro[3.4]octan-6-yl)-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
|---|---|
| PubChem CID | 87582835 |
| Molecular Formula | C20H20FN5O3S |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 9-cyclopropyl-6-fluoro-7-(8-methoxyimino-2,6-diazaspiro[3.4]octan-6-yl)-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
| SMILES | CON=C1CN(c2cc3c(cc2F)c(=O)c2c(=O)[nH]sc2n3C2CC2)CC12CNC2 |
| InChI | InChI=1S/C20H20FN5O3S/c1-29-23-15-6-25(9-20(15)7-22-8-20)14-5-13-11(4-12(14)21)17(27)16-18(28)24-30-19(16)26(13)10-2-3-10/h4-5,10,22H,2-3,6-9H2,1H3,(H,24,28) |
| InChIKey | QKTFTSYLTCMZOV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|