C25H24FN5O3S — CID 91070208
7-[3-(aminomethyl)-4-phenylmethoxyiminopyrrolidin-1-yl]-9-cyclopropyl-6-fluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione (PubChem CID 91070208) has the molecular formula C25H24FN5O3S and a molecular weight of 493.56 g/mol. Its IUPAC name is 7-[3-(aminomethyl)-4-phenylmethoxyiminopyrrolidin-1-yl]-9-cyclopropyl-6-fluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione.
| Compound Name | 7-[3-(aminomethyl)-4-phenylmethoxyiminopyrrolidin-1-yl]-9-cyclopropyl-6-fluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
|---|---|
| PubChem CID | 91070208 |
| Molecular Formula | C25H24FN5O3S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 7-[3-(aminomethyl)-4-phenylmethoxyiminopyrrolidin-1-yl]-9-cyclopropyl-6-fluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
| SMILES | NCC1CN(c2cc3c(cc2F)c(=O)c2c(=O)[nH]sc2n3C2CC2)CC1=NOCc1ccccc1 |
| InChI | InChI=1S/C25H24FN5O3S/c26-18-8-17-20(31(16-6-7-16)25-22(23(17)32)24(33)29-35-25)9-21(18)30-11-15(10-27)19(12-30)28-34-13-14-4-2-1-3-5-14/h1-5,8-9,15-16H,6-7,10-13,27H2,(H,29,33) |
| InChIKey | IAYDCQXATOAQKD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|