C29H32F2N2O3S — CID 87586243
N-[4-[[benzenesulfonyl-[(3,4-difluorophenyl)methyl]amino]methyl]cyclohexyl]-N-[(4-methylphenyl)methyl]formamide (PubChem CID 87586243) has the molecular formula C29H32F2N2O3S and a molecular weight of 526.65 g/mol. Its IUPAC name is N-[4-[[benzenesulfonyl-[(3,4-difluorophenyl)methyl]amino]methyl]cyclohexyl]-N-[(4-methylphenyl)methyl]formamide.
| Compound Name | N-[4-[[benzenesulfonyl-[(3,4-difluorophenyl)methyl]amino]methyl]cyclohexyl]-N-[(4-methylphenyl)methyl]formamide |
|---|---|
| PubChem CID | 87586243 |
| Molecular Formula | C29H32F2N2O3S |
| Molecular Weight | 526.65 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | N-[4-[[benzenesulfonyl-[(3,4-difluorophenyl)methyl]amino]methyl]cyclohexyl]-N-[(4-methylphenyl)methyl]formamide |
| SMILES | Cc1ccc(CN(C=O)C2CCC(CN(Cc3ccc(F)c(F)c3)S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H32F2N2O3S/c1-22-7-9-23(10-8-22)18-32(21-34)26-14-11-24(12-15-26)19-33(20-25-13-16-28(30)29(31)17-25)37(35,36)27-5-3-2-4-6-27/h2-10,13,16-17,21,24,26H,11-12,14-15,18-20H2,1H3 |
| InChIKey | FOMVYZPMXKFGKS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.65 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|