C15H15AsBrN2O — CID 87586467
CID 87586467 (PubChem CID 87586467) has the molecular formula C15H15AsBrN2O and a molecular weight of 394.12 g/mol.
| Compound Name | CID 87586467 |
|---|---|
| PubChem CID | 87586467 |
| Molecular Formula | C15H15AsBrN2O |
| Molecular Weight | 394.12 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | — |
| SMILES | Cc1nc([As][C@@H]2c3ccccc3C[C@@H]2O)c(C)nc1Br |
| InChI | InChI=1S/C15H15AsBrN2O/c1-8-14(18-9(2)15(17)19-8)16-13-11-6-4-3-5-10(11)7-12(13)20/h3-6,12-13,20H,7H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | CQTPIMYNAMCOOF-QWHCGFSZSA-N |
| XLogP | 1.84 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.12 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|