C16H40O16P6S4Zn — CID 87587439
zinc bis([[butoxy(hydroxy)phosphoryl]oxy-sulfidophosphinothioyl] butyl hydrogen phosphate) (PubChem CID 87587439) has the molecular formula C16H40O16P6S4Zn and a molecular weight of 867.98 g/mol. Its IUPAC name is zinc bis([[butoxy(hydroxy)phosphoryl]oxy-sulfidophosphinothioyl] butyl hydrogen phosphate).
| Compound Name | zinc bis([[butoxy(hydroxy)phosphoryl]oxy-sulfidophosphinothioyl] butyl hydrogen phosphate) |
|---|---|
| PubChem CID | 87587439 |
| Molecular Formula | C16H40O16P6S4Zn |
| Molecular Weight | 867.98 g/mol |
| Exact Mass | 865.89 |
| IUPAC Name | zinc bis([[butoxy(hydroxy)phosphoryl]oxy-sulfidophosphinothioyl] butyl hydrogen phosphate) |
| SMILES | CCCCOP(=O)(O)OP(=S)([S-])OP(=O)(O)OCCCC.CCCCOP(=O)(O)OP(=S)([S-])OP(=O)(O)OCCCC.[Zn+2] |
| InChI | InChI=1S/2C8H21O8P3S2.Zn/c2*1-3-5-7-13-17(9,10)15-19(20,21)16-18(11,12)14-8-6-4-2;/h2*3-8H2,1-2H3,(H,9,10)(H,11,12)(H,20,21);/q;;+2/p-2 |
| InChIKey | GSWZPSRFQXGQSH-UHFFFAOYSA-L |
| XLogP | 7.25 |
| TPSA | 223.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.98 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|