C22H18ClN7OS — CID 87589541
6-chloro-N-[[4-[12-methyl-8-(methylamino)-3-thia-5,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-4-yl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 87589541) has the molecular formula C22H18ClN7OS and a molecular weight of 463.95 g/mol. Its IUPAC name is 6-chloro-N-[[4-[12-methyl-8-(methylamino)-3-thia-5,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-4-yl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[[4-[12-methyl-8-(methylamino)-3-thia-5,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-4-yl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87589541 |
| Molecular Formula | C22H18ClN7OS |
| Molecular Weight | 463.95 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 6-chloro-N-[[4-[12-methyl-8-(methylamino)-3-thia-5,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-4-yl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | CNc1nc2nc(-c3ccc(CNC(=O)c4ccc(Cl)nc4)cc3)sc2c2c1ncn2C |
| InChI | InChI=1S/C22H18ClN7OS/c1-24-19-16-17(30(2)11-27-16)18-20(28-19)29-22(32-18)13-5-3-12(4-6-13)9-26-21(31)14-7-8-15(23)25-10-14/h3-8,10-11H,9H2,1-2H3,(H,24,28)(H,26,31) |
| InChIKey | CKLCLZBEBQLJFN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.95 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|