C14H25N3O2S — CID 87590150
(2S)-N-[(2R)-1-(dimethylamino)-3-methyl-1-oxobutan-2-yl]-2-isothiocyanato-3,3-dimethylbutanamide (PubChem CID 87590150) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is (2S)-N-[(2R)-1-(dimethylamino)-3-methyl-1-oxobutan-2-yl]-2-isothiocyanato-3,3-dimethylbutanamide.
| Compound Name | (2S)-N-[(2R)-1-(dimethylamino)-3-methyl-1-oxobutan-2-yl]-2-isothiocyanato-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 87590150 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (2S)-N-[(2R)-1-(dimethylamino)-3-methyl-1-oxobutan-2-yl]-2-isothiocyanato-3,3-dimethylbutanamide |
| SMILES | CC(C)[C@@H](NC(=O)[C@@H](N=C=S)C(C)(C)C)C(=O)N(C)C |
| InChI | InChI=1S/C14H25N3O2S/c1-9(2)10(13(19)17(6)7)16-12(18)11(15-8-20)14(3,4)5/h9-11H,1-7H3,(H,16,18)/t10-,11-/m1/s1 |
| InChIKey | WXNKJQFSALGREA-GHMZBOCLSA-N |
| XLogP | 1.73 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|