About (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate
(3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate (PubChem CID 87592486) has the molecular formula C8H16NO4P
and a molecular weight of 221.19 g/mol. Its IUPAC name is (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate.
Molecular Properties
| Compound Name | (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate |
| PubChem CID | 87592486 |
| Molecular Formula | C8H16NO4P |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate |
| SMILES | CC(C)C(C#N)(OP(=O)(O)O)C(C)C |
| InChI | InChI=1S/C8H16NO4P/c1-6(2)8(5-9,7(3)4)13-14(10,11)12/h6-7H,1-4H3,(H2,10,11,12) |
| InChIKey | IAUJQGZYWKNMDO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate?
The IUPAC name of (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate (CID 87592486) is (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate.
What is the SMILES notation for (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate?
The canonical SMILES for (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate is CC(C)C(C#N)(OP(=O)(O)O)C(C)C.
What is the InChIKey of (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate?
The InChIKey is IAUJQGZYWKNMDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16NO4P/c1-6(2)8(5-9,7(3)4)13-14(10,11)12/h6-7H,1-4H3,(H2,10,11,12).
What are the key properties of (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate?
(3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate has a molecular weight of 221.19 g/mol, XLogP of 1.67, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-2,4-dimethylpentan-3-yl) dihydrogen phosphate is sourced from PubChem (CID 87592486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).