C11H21N3O3S — CID 87593874
tert-butyl 4-[carbamoyl(sulfanyl)amino]piperidine-1-carboxylate (PubChem CID 87593874) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is tert-butyl 4-[carbamoyl(sulfanyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[carbamoyl(sulfanyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87593874 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | tert-butyl 4-[carbamoyl(sulfanyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(S)C(N)=O)CC1 |
| InChI | InChI=1S/C11H21N3O3S/c1-11(2,3)17-10(16)13-6-4-8(5-7-13)14(18)9(12)15/h8,18H,4-7H2,1-3H3,(H2,12,15) |
| InChIKey | PDQNCZNWKCFNEQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|