C19H25NO5 — CID 87594094
2-benzyl-4-(1-ethoxy-1,4-dioxobutan-2-yl)piperidine-1-carboxylic acid (PubChem CID 87594094) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-benzyl-4-(1-ethoxy-1,4-dioxobutan-2-yl)piperidine-1-carboxylic acid.
| Compound Name | 2-benzyl-4-(1-ethoxy-1,4-dioxobutan-2-yl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87594094 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-benzyl-4-(1-ethoxy-1,4-dioxobutan-2-yl)piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)C(CC=O)C1CCN(C(=O)O)C(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H25NO5/c1-2-25-18(22)17(9-11-21)15-8-10-20(19(23)24)16(13-15)12-14-6-4-3-5-7-14/h3-7,11,15-17H,2,8-10,12-13H2,1H3,(H,23,24) |
| InChIKey | GUBMWJPZHVCGHE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|