C24H51NO4 — CID 87595066
3-(dimethylamino)-4-methylpentane-2,3-diol;2-methylpentadecanoic acid (PubChem CID 87595066) has the molecular formula C24H51NO4 and a molecular weight of 417.68 g/mol. Its IUPAC name is 3-(dimethylamino)-4-methylpentane-2,3-diol;2-methylpentadecanoic acid.
| Compound Name | 3-(dimethylamino)-4-methylpentane-2,3-diol;2-methylpentadecanoic acid |
|---|---|
| PubChem CID | 87595066 |
| Molecular Formula | C24H51NO4 |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 417.38 |
| IUPAC Name | 3-(dimethylamino)-4-methylpentane-2,3-diol;2-methylpentadecanoic acid |
| SMILES | CC(C)C(O)(C(C)O)N(C)C.CCCCCCCCCCCCCC(C)C(=O)O |
| InChI | InChI=1S/C16H32O2.C8H19NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(2)16(17)18;1-6(2)8(11,7(3)10)9(4)5/h15H,3-14H2,1-2H3,(H,17,18);6-7,10-11H,1-5H3 |
| InChIKey | KLUWKMXAKYPMQC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|