About CID 87596702
CID 87596702 (PubChem CID 87596702) has the molecular formula C3H3BF3O
and a molecular weight of 122.86 g/mol.
Molecular Properties
| Compound Name | CID 87596702 |
| PubChem CID | 87596702 |
| Molecular Formula | C3H3BF3O |
| Molecular Weight | 122.86 g/mol |
| Exact Mass | 123.02 |
| IUPAC Name | — |
| SMILES | CO[B]C(F)=C(F)F |
| InChI | InChI=1S/C3H3BF3O/c1-8-4-2(5)3(6)7/h1H3 |
| InChIKey | KLAPMPYBYPWBTH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.86 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87596702 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87596702?
The IUPAC name of CID 87596702 (CID 87596702) is not available.
What is the SMILES notation for CID 87596702?
The canonical SMILES for CID 87596702 is CO[B]C(F)=C(F)F.
What is the InChIKey of CID 87596702?
The InChIKey is KLAPMPYBYPWBTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3BF3O/c1-8-4-2(5)3(6)7/h1H3.
What are the key properties of CID 87596702?
CID 87596702 has a molecular weight of 122.86 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87596702 is sourced from PubChem (CID 87596702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).