C5H6F3NO2 — CID 158661310
methyl cyanate;1,1,2-trifluoro-2-methoxyethene (PubChem CID 158661310) has the molecular formula C5H6F3NO2 and a molecular weight of 169.10 g/mol. Its IUPAC name is methyl cyanate;1,1,2-trifluoro-2-methoxyethene.
| Compound Name | methyl cyanate;1,1,2-trifluoro-2-methoxyethene |
|---|---|
| PubChem CID | 158661310 |
| Molecular Formula | C5H6F3NO2 |
| Molecular Weight | 169.10 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | methyl cyanate;1,1,2-trifluoro-2-methoxyethene |
| SMILES | COC#N.COC(F)=C(F)F |
| InChI | InChI=1S/C3H3F3O.C2H3NO/c1-7-3(6)2(4)5;1-4-2-3/h1H3;1H3 |
| InChIKey | ICUHECOVLNJWOY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.10 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|