C12H16N4O3S — CID 87597495
4-carbamothioyl-3-(pyridin-3-yloxymethyl)piperazine-1-carboxylic acid (PubChem CID 87597495) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-carbamothioyl-3-(pyridin-3-yloxymethyl)piperazine-1-carboxylic acid.
| Compound Name | 4-carbamothioyl-3-(pyridin-3-yloxymethyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87597495 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-carbamothioyl-3-(pyridin-3-yloxymethyl)piperazine-1-carboxylic acid |
| SMILES | NC(=S)N1CCN(C(=O)O)CC1COc1cccnc1 |
| InChI | InChI=1S/C12H16N4O3S/c13-11(20)16-5-4-15(12(17)18)7-9(16)8-19-10-2-1-3-14-6-10/h1-3,6,9H,4-5,7-8H2,(H2,13,20)(H,17,18) |
| InChIKey | CZYFICAADXVAJP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|